| Status: | none |
|---|---|
| IUPAC: | benzyl benzoate |
| CAS: | phenylmethyl benzoate |
| Reg. No.: | 120-51-4 |
| Formula: | C14H12O2 |
| Activity: | acaricides (bridged diphenyl acaricides) |
| Notes: | There is no ISO common name for this substance; the name “benzyl benzoate” has been used in the literature but it has no official status except as a systematic name. |
| Structure: | ![]() |
| Pronunciation: | běn-zīl běn-zō-āt Guide to British pronunciation |
| InChIKey: | SESFRYSPDFLNCH-UHFFFAOYSA-N |
| InChI: | InChI=1S/C14H12O2/c15-14(13-9-5-2-6-10-13)16-11-12-7-3-1-4-8-12/h1-10H,11H2 |
A data sheet from the Compendium of Pesticide Common Names