| Status: | ISO 1750 (approved) |
|---|---|
| IUPAC: | (EZ)-3-[benzyl(methyl)amino]-2-cyanoacrylic acid |
| CAS: | 2-cyano-3-[methyl(phenylmethyl)amino]-2-propenoic acid |
| Reg. No.: | 127087-86-9 |
| Formula: | C12H12N2O2 |
| Activity: | fungicides (unclassified fungicides) |
| Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example benzamacril-isobutyl [88107-27-1]. |
| Structure: | ![]() |
| Pronunciation: | běnz-ǎm-a-krǐl Guide to British pronunciation |
| InChI: | InChI=1/C12H12N2O2/c1-14(9-11(7-13)12(15)16)8-10-5-3-2-4-6-10/h2-6,9H,8H2,1H3,(H,15,16)/f/h15H |
A data sheet from the Compendium of Pesticide Common Names