Approval: | ISO |
---|---|
IUPAC PIN: | (benzamidooxy)acetic acid |
IUPAC name: | (benzamidooxy)acetic acid |
CAS name: | 2-[(benzoylamino)oxy]acetic acid |
CAS Reg. No.: | 5251-93-4 |
Formula: | C9H9NO4 |
Activity: | herbicides (unclassified) |
Notes: | The name “benzadox” was formerly approved by the British Standards Institution and was adopted by ISO in 2020. When this substance is used as a salt, its identity should be stated, for example benzadox-ammonium [5251-79-6]. |
Structure: | |
Pronunciation: | běnz-a-dǒks Guide to British pronunciation |
InChIKey: | WDRGQGLIUAMOOC-UHFFFAOYSA-N |
InChI: | InChI=1S/C9H9NO4/c11-8(12)6-14-10-9(13)7-4-2-1-3-5-7/h1-5H,6H2,(H,10,13)(H,11,12) |
A data sheet from the Compendium of Pesticide Common Names