| Status: | BSI |
|---|---|
| IUPAC: | benzamidooxyacetic acid |
| CAS: | [(benzoylamino)oxy]acetic acid |
| Reg. No.: | 5251-93-4 |
| Formula: | C9H9NO4 |
| Activity: | herbicides (amide herbicides) |
| Notes: | There is no ISO common name for this substance; the name “benzadox” is approved by the British Standards Institution and the Weed Science Society of America. When this substance is used as a salt, its identity should be stated, for example benzadox-ammonium [5251-79-6]. |
| Structure: |  |
| Pronunciation: | běnz-a-dǒks Guide to British pronunciation |
| InChI: | InChI=1/C9H9NO4/c11-8(12)6-14-10-9(13)7-4-2-1-3-5-7/h1-5H,6H2,(H,10,13)(H,11,12)/f/h10-11H |