| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 4-chloro-2,3-dihydro-2-oxo-1,3-benzothiazol-3-ylacetic acid |
| CAS: | 4-chloro-2-oxo-3(2H)-benzothiazoleacetic acid |
| Reg. No.: | 3813-05-6 |
| Formula: | C9H6ClNO3S |
| Activity: | herbicides (benzothiazole herbicides) |
| Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example benazolin-dimethylammonium [38561-76-1], benazolin-ethyl [25059-80-7], benazolin-potassium [67338-65-2]. The US Food and Drug Administration uses the name “benazoline” for the unrelated drug that has the INN “metizoline”. |
| Structure: |  |
| Pronunciation: | běn-āz-ō-lǐn Guide to British pronunciation |
| InChI: | InChI=1/C9H6ClNO3S/c10-5-2-1-3-6-8(5)11(4-7(12)13)9(14)15-6/h1-3H,4H2,(H,12,13)/f/h12H |