Approval: | ISO |
---|---|
IUPAC name: | methyl N-(2,6-dimethylphenyl)-N-(phenylacetyl)-DL-alaninate 1979 Rules: methyl N-(phenylacetyl)-N-(2,6-xylyl)-DL-alaninate |
CAS name: | methyl N-(2,6-dimethylphenyl)-N-(phenylacetyl)-DL-alaninate |
CAS Reg. No.: | 71626-11-4 |
Formula: | C20H23NO3 |
Activity: | fungicides (acylalanine) |
Notes: | The (−)-enantiomer of this substance has the ISO common name benalaxyl-M [98243-83-5]. |
Structure: | |
Pronunciation: | běn-a-lǎks-ǐl Guide to British pronunciation |
InChIKey: | CJPQIRJHIZUAQP-UHFFFAOYSA-N |
InChI: | InChI=1S/C20H23NO3/c1-14-9-8-10-15(2)19(14)21(16(3)20(23)24-4)18(22)13-17-11-6-5-7-12-17/h5-12,16H,13H2,1-4H3 |
A data sheet from the Compendium of Pesticide Common Names