| Status: | WSSA |
|---|---|
| IUPAC: | (RS)-sec-butyl 3-chlorocarbanilate |
| CAS: | 1-methylpropyl N-(3-chlorophenyl)carbamate |
| Reg. No.: | 2164-13-8 |
| Formula: | C11H14ClNO2 |
| Activity: | herbicides (carbanilate herbicides) |
| Notes: | There is no ISO common name for this substance; the name “BCPC” is approved by the Weed Science Society of America. |
| Structure: | ![]() |
| Pronunciation: | bē sē pē sē Guide to British pronunciation |
| InChIKey: | CURLHBZYTFVCRG-UHFFFAOYSA-N |
| InChI: | InChI=1S/C11H14ClNO2/c1-3-8(2)15-11(14)13-10-6-4-5-9(12)7-10/h4-8H,3H2,1-2H3,(H,13,14) |
A data sheet from the Compendium of Pesticide Common Names