| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 4-chlorobut-2-ynyl 3-chlorocarbanilate |
| CAS: | 4-chloro-2-butyn-1-yl N-(3-chlorophenyl)carbamate |
| Reg. No.: | 101-27-9 |
| Formula: | C11H9Cl2NO2 |
| Activity: | herbicides (carbanilate herbicides) |
| Notes: | The name “barbanate” is used in South Africa, and the name “chlorinate” (хлоринат) was used in the former USSR. |
| Structure: | ![]() |
| Pronunciation: | bar-bǎn Guide to British pronunciation |
| InChIKey: | MCOQHIWZJUDQIC-UHFFFAOYSA-N |
| InChI: | InChI=1S/C11H9Cl2NO2/c12-6-1-2-7-16-11(15)14-10-5-3-4-9(13)8-10/h3-5,8H,6-7H2,(H,14,15) |
A data sheet from the Compendium of Pesticide Common Names