Status: | ISO 765 (published) |
---|---|
IUPAC PIN: | diphenyldiazene |
IUPAC name: | azobenzene |
CAS name: | 1,2-diphenyldiazene |
CAS Reg. No.: | 103-33-3 |
Formula: | C12H10N2 |
Activity: | acaricides (unclassified) |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
Structure: | |
Pronunciation: | āz-ō-běn-zēn Guide to British pronunciation |
InChIKey: | DMLAVOWQYNRWNQ-UHFFFAOYSA-N |
InChI: | InChI=1S/C12H10N2/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12/h1-10H |
A data sheet from the Compendium of Pesticide Common Names