
Chinese: 莠去津French: atrazine (n.f.)Russian: атразин

Status: ISO 1750 (published)
IUPAC PIN: 6-chloro-N2-ethyl-N4-(propan-2-yl)-1,3,5-triazine-2,4-diamine
IUPAC name: 6-chloro-N2-ethyl-N4-isopropyl-1,3,5-triazine-2,4-diamine
pre-1969 name:
CAS name: 6-chloro-N2-ethyl-N4-(1-methylethyl)-1,3,5-triazine-2,4-diamine
CAS Reg. No.: 1912-24-9
Formula: C8H14ClN5
Activity: herbicides (chlorotriazine herbicides)
Structure: Structural formula of atrazine
Pronunciation: ǎt-ra-zēn  Guide to British pronunciation
InChI: InChI=1S/C8H14ClN5/c1-4-10-7-12-6(9)13-8(14-7)11-5(2)3/h5H,4H2,1-3H3,(H2,10,11,12,13,14)

A data sheet from the Compendium of Pesticide Common Names