
French: atraton (n.m.)Russian: атратон

Status: ISO 1750 (published)
IUPAC PIN: N2-ethyl-6-methoxy-N4-(propan-2-yl)-1,3,5-triazine-2,4-diamine
IUPAC name: N2-ethyl-N4-isopropyl-6-methoxy-1,3,5-triazine-2,4-diamine
pre-1969 name:
CAS name: N2-ethyl-6-methoxy-N4-(1-methylethyl)-1,3,5-triazine-2,4-diamine
CAS Reg. No.: 1610-17-9
Formula: C9H17N5O
Activity: herbicides (methoxytriazine herbicides)
Structure: Structural formula of atraton
Pronunciation: ǎt-ra-tǒn  Guide to British pronunciation
InChI: InChI=1S/C9H17N5O/c1-5-10-7-12-8(11-6(2)3)14-9(13-7)15-4/h6H,5H2,1-4H3,(H2,10,11,12,13,14)

A data sheet from the Compendium of Pesticide Common Names