| Status: | China |
|---|---|
| IUPAC: | arsinetriyl tris(dimethyldithiocarbamate) or 1-{[bis(dimethylthiocarbamoylsulfanyl)arsanyl]sulfanyl}-N,N-dimethylmethanethioamide or tris(dimethylthiocarbamoylthio)arsine |
| CAS: | N,N-dimethylcarbamodithioic acid tris(anhydrosulfide) with arsenotrithious acid |
| Reg. No.: | 3586-60-5 |
| Formula: | C9H18AsN3S6 |
| Activity: | fungicides (arsenical fungicides; dithiocarbamate fungicides) |
| Notes: | There is no ISO common name for this substance; the name “asomate” (福美胂) is approved in China. |
| Structure: |  |
| Pronunciation: | ā-sō-māt Guide to British pronunciation |
| InChIKey: | GAMFEMAXLMWCRG-UHFFFAOYSA-N |
| InChI: | InChI=1S/C9H18AsN3S6/c1-11(2)7(14)17-10(18-8(15)12(3)4)19-9(16)13(5)6/h1-6H3 |