Status: | ISO 765 (published) |
---|---|
IUPAC PIN: | anthracene-9,10-dione |
IUPAC name: | anthracene-9,10-dione 1979 Rules: anthraquinone |
CAS name: | 9,10-anthracenedione |
CAS Reg. No.: | 84-65-1 |
Formula: | C14H8O2 |
Activity: | bird repellents |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
Structure: | |
Pronunciation: | ǎn-thra-kwǐn-ōn Guide to British pronunciation |
InChIKey: | RZVHIXYEVGDQDX-UHFFFAOYSA-N |
InChI: | InChI=1S/C14H8O2/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13/h1-8H |
A data sheet from the Compendium of Pesticide Common Names