| Status: | none |
|---|---|
| IUPAC: | (S)-3-(2-piperidyl)pyridine |
| CAS: | 3-(2S)-2-piperidinylpyridine |
| Reg. No.: | 494-52-0 |
| Formula: | C10H14N2 |
| Activity: | insecticides (botanical insecticides) |
| Notes: | There is no ISO common name for this substance; the name “anabasine” has been used in the literature but has no official status. |
| Structure: | ![]() |
| Pronunciation: | a-nǎb-a-sēn Guide to British pronunciation |
| InChI: | InChI=1/C10H14N2/c1-2-7-12-10(5-1)9-4-3-6-11-8-9/h3-4,6,8,10,12H,1-2,5,7H2/t10-/m0/s1 |
A data sheet from the Compendium of Pesticide Common Names