| Status: | China |
|---|---|
| IUPAC: | S-allyl prop-2-ene-1-sulfinothioate |
| CAS: | S-2-propen-1-yl 2-propene-1-sulfinothioate |
| Reg. No.: | 539-86-6 |
| Formula: | C6H10OS2 |
| Activity: | fungicides (botanical fungicides) insecticides (botanical insecticides) molluscicides |
| Notes: | There is no ISO common name for this substance; the trivial name “allicin” (大蒜素) is approved as a common name in China. |
| Structure: | ![]() |
| Pronunciation: | ǎl-ǐ-sǐn Guide to British pronunciation |
| InChIKey: | JDLKFOPOAOFWQN-UHFFFAOYSA-N |
| InChI: | InChI=1S/C6H10OS2/c1-3-5-8-9(7)6-4-2/h3-4H,1-2,5-6H2 |
A data sheet from the Compendium of Pesticide Common Names