| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 4-alkyl-2,5(or 2,6)-dimethylmorpholines, containing 65–75% 2,6-dimethylmorpholines and 25–35% 2,5-dimethylmorpholines, where more than 85% of the total is 4-dodecyl-2,5(or 2,6)-dimethylmorpholine, and where “alkyl” may also be octyl, decyl, tetradecyl or hexadecyl, and where the cis/trans ratio is 1:1 |
| CAS: | aldimorph |
| Reg. No.: | 91315-15-0 |
| Formula: | C18H37NO (major component) |
| Activity: | fungicides (morpholine fungicides) |
| Notes: | |
| Structure: |  |
| InChI: | InChI=1/C18H37NO/c1-4-5-6-7-8-9-10-11-12-13-14-19-15-17(2)20-18(3)16-19/h17-18H,4-16H2,1-3H3 (major component) |