Status: | USSR |
---|---|
IUPAC PIN: | 1-[(hexyloxy)methyl]azepan-2-one |
IUPAC name: | N-[(hexyloxy)methyl]hexano-6-lactam 1979 rules: N-[(hexyloxy)methyl]-ε-caprolactam |
CAS name: | 1-[(hexyloxy)methyl]hexahydro-2H-azepin-2-one |
CAS Reg. No.: | |
Formula: | C13H25NO2 |
Activity: | insect repellents |
Notes: | There is no ISO common name for this substance; the name “acrep” (акреп) was used in the former USSR. |
Structure: | |
Pronunciation: | ǎk-krěp Guide to British pronunciation |
InChIKey: | IXCJFHRRPLTTSW-UHFFFAOYSA-N |
InChI: | InChI=1S/C13H25NO2/c1-2-3-4-8-11-16-12-14-10-7-5-6-9-13(14)15/h2-12H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names