| Status: | none |
|---|---|
| IUPAC: | 1-aminocyclopropanecarboxylic acid |
| CAS: | 1-aminocyclopropanecarboxylic acid |
| Reg. No.: | 22059-21-8 |
| Formula: | C4H7NO2 |
| Activity: | plant growth regulators (ethylene releasers) |
| Notes: | There is no ISO common name for this substance; the name “ACC” has been used in the literature but has no official status. |
| Structure: | ![]() |
| Pronunciation: | ā sē sē Guide to British pronunciation |
| InChI: | InChI=1/C4H7NO2/c5-4(1-2-4)3(6)7/h1-2,5H2,(H,6,7)/f/h6H |
A data sheet from the Compendium of Pesticide Common Names