| Status: | ISO 765 |
|---|---|
| IUPAC: | 1-naphthylacetic acid |
| CAS: | 1-naphthaleneacetic acid |
| Reg. No.: | 86-87-3 |
| Formula: | C12H10O2 |
| Activity: | plant growth regulators (auxins) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name; “naphthylacetic acid” is given as an alternative. The name “NAA” has been used in the literature but has no official status. |
| Structure: | ![]() |
| InChI: | InChI=1/C12H10O2/c13-12(14)8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7H,8H2,(H,13,14)/f/h13H |
A data sheet from the Compendium of Pesticide Common Names