| Status: | none |
|---|---|
| IUPAC: | (RS)-3-chloropropylene glycol |
| CAS: | 3-chloro-1,2-propanediol |
| Reg. No.: | 96-24-2 |
| Formula: | C3H7ClO2 |
| Activity: | rodenticides (unclassified rodenticides) |
| Notes: | There is no ISO common name for this substance; the name “α-chlorohydrin” has been used in the literature but it has no official status. |
| Structure: | ![]() |
| Pronunciation: | ǎl-fa klor-ō-hī-drǐn Guide to British pronunciation |
| InChIKey: | SSZWWUDQMAHNAQ-UHFFFAOYSA-N |
| InChI: | InChI=1S/C3H7ClO2/c4-1-3(6)2-5/h3,5-6H,1-2H2 |
A data sheet from the Compendium of Pesticide Common Names