| Status: | BS 1831c |
|---|---|
| IUPAC: | phenylmercury(II) quinolin-8-olate or phenylmercury(2+) quinolin-8-olate or phenylmercuric quinolin-8-olate |
| CAS: | phenyl(8-quinolinolato-κO)mercury |
| Reg. No.: | 14354-56-4 |
| Formula: | C15H11HgNO |
| Activity: | fungicides (organomercury fungicides) |
| Notes: | This substance is considered by the British Standards Institution not to require a common name. |
| Structure: | ![]() |
| Pronunciation: | āt fē-nīl-mer-kūr-ē-ǒk-sē-kwǐn-a-lēn Guide to British pronunciation |
| InChI: | InChI=1/C9H7NO.C6H5.Hg/c11-8-5-1-3-7-4-2-6-10-9(7)8;1-2-4-6-5-3-1;/h1-6,11H;1-5H;/q;;+1/p-1/fC9H6NO.C6H5.Hg/h11h;;/q-1;;m/rC15H11HgNO/c1-2-8-13(9-3-1)16-18-14-10-4-6-12-7-5-11-17-15(12)14/h1-11H |
A data sheet from the Compendium of Pesticide Common Names