| Approval: | WSSA |
|---|---|
| IUPAC PIN: | rac-(2R)-2-(4-chlorophenoxy)propanoic acid |
| IUPAC name: | (2RS)-2-(4-chlorophenoxy)propanoic acid 1979 Rules: (RS)-2-(4-chlorophenoxy)propionic acid |
| CAS name: | 2-(4-chlorophenoxy)propanoic acid |
| CAS Reg. No.: | 3307-39-9 |
| Formula: | C9H9ClO3 |
| Activity: | herbicides (phenoxypropionic) |
| Notes: | There is no ISO common name for this substance; the name “4-CPP” is approved by the Weed Science Society of America. |
| Structure: |  |
| Pronunciation: | for sē pē pē Guide to British pronunciation |
| InChIKey: | DKHJWWRYTONYHB-UHFFFAOYSA-N |
| InChI: | InChI=1S/C9H9ClO3/c1-6(9(11)12)13-8-4-2-7(10)3-5-8/h2-6H,1H3,(H,11,12) |