| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 4-chlorophenoxyacetic acid |
| CAS: | (4-chlorophenoxy)acetic acid |
| Reg. No.: | 122-88-3 |
| Formula: | C8H7ClO3 |
| Activity: | herbicides (phenoxyacetic herbicides) plant growth regulators (auxins) |
| Notes: | The name “4-ChFU” (4-ХФУ) was used in the former USSR. |
| Structure: | ![]() |
| Pronunciation: | for sē pē ā Guide to British pronunciation |
| InChI: | InChI=1/C8H7ClO3/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5H2,(H,10,11)/f/h10H |
A data sheet from the Compendium of Pesticide Common Names