| Status: | WSSA |
|---|---|
| IUPAC: | (RS)-2-(3,4-dichlorophenoxy)propionic acid |
| CAS: | 2-(3,4-dichlorophenoxy)propanoic acid |
| Reg. No.: | 3307-41-3 |
| Formula: | C9H8Cl2O3 |
| Activity: | herbicides (phenoxypropionic herbicides) |
| Notes: | There is no ISO common name for this substance; the name “3,4-DP” is approved by the Weed Science Society of America. |
| Structure: | ![]() |
| Pronunciation: | thrē for dē pē Guide to British pronunciation |
| InChIKey: | JSAPFNPRLYFXQD-UHFFFAOYSA-N |
| InChI: | InChI=1S/C9H8Cl2O2/c1-5(9(12)13)6-2-3-7(10)8(11)4-6/h2-5H,1H3,(H,12,13) |
A data sheet from the Compendium of Pesticide Common Names