| Status: | WSSA |
|---|---|
| IUPAC: | (3,4-dichlorophenoxy)acetic acid |
| CAS: | (3,4-dichlorophenoxy)acetic acid |
| Reg. No.: | 588-22-7 |
| Formula: | C8H6Cl2O3 |
| Activity: | herbicides (phenoxyacetic herbicides) |
| Notes: | There is no ISO common name for this substance; the name “3,4-DA” is approved by the Weed Science Society of America. |
| Structure: | ![]() |
| Pronunciation: | thrē for dē ā Guide to British pronunciation |
| InChI: | InChI=1/C8H6Cl2O3/c9-6-2-1-5(3-7(6)10)13-4-8(11)12/h1-3H,4H2,(H,11,12)/f/h11H |
A data sheet from the Compendium of Pesticide Common Names