| Status: | ISO 765 |
|---|---|
| IUPAC: | biphenyl-2-ol |
| CAS: | [1,1′-biphenyl]-2-ol |
| Reg. No.: | 90-43-7 |
| Formula: | C12H10O |
| Activity: | fungicides (unclassified fungicides) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. The sodium salt is also considered by the International Organization for Standardization not to require a common name, see sodium orthophenylphenoxide. |
| Structure: |  |
| Pronunciation: | too fē-nīl-fē-nǒl Guide to British pronunciation |
| InChI: | InChI=1/C12H10O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9,13H |