| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 2,3,6-trichlorobenzoic acid |
| CAS: | 2,3,6-trichlorobenzoic acid |
| Reg. No.: | 50-31-7 |
| Formula: | C7H3Cl3O2 |
| Activity: | herbicides (benzoic acid herbicides) |
| Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example 2,3,6-TBA-dimethylammonium [3426-62-8], 2,3,6-TBA-sodium [2078-42-4]. The name “TCBA” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. |
| Structure: | ![]() |
| Pronunciation: | too thrē sǐks tē bē ā Guide to British pronunciation |
| InChI: | InChI=1/C7H3Cl3O2/c8-3-1-2-4(9)6(10)5(3)7(11)12/h1-2H,(H,11,12)/f/h11H |
A data sheet from the Compendium of Pesticide Common Names