| Status: | BS 1831c |
|---|---|
| IUPAC: | 2,3,5-triiodobenzoic acid |
| CAS: | 2,3,5-triiodobenzoic acid |
| Reg. No.: | 88-82-4 |
| Formula: | C7H3I3O2 |
| Activity: | plant growth regulators (antiauxins; growth inhibitors) |
| Notes: | This substance is considered by the British Standards Institution not to require a common name. The name “TIBA” has been used in the literature but has no official status. |
| Structure: |  |
| InChI: | InChI=1/C7H3I3O2/c8-3-1-4(7(11)12)6(10)5(9)2-3/h1-2H,(H,11,12)/f/h11H |