Status: | ISO 765 (published) |
---|---|
IUPAC PIN: | naphthalen-1-ol |
IUPAC name: | 1-naphthol |
CAS name: | 1-naphthalenol |
CAS Reg. No.: | 90-15-3 |
Formula: | C10H8O |
Activity: | plant growth regulators (auxin) |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
Structure: | |
Pronunciation: | wǔn nǎf-thǒl Guide to British pronunciation |
InChIKey: | KJCVRFUGPWSIIH-UHFFFAOYSA-N |
InChI: | InChI=1S/C10H8O/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7,11H |
A data sheet from the Compendium of Pesticide Common Names