| Status: | none |
|---|---|
| IUPAC: | 1-naphthol |
| CAS: | 1-naphthalenol |
| Reg. No.: | 90-15-3 |
| Formula: | C10H8O |
| Activity: | plant growth regulators (auxins) |
| Notes: | There is no ISO common name for this substance; the name “1-naphthol” has been used in the literature but has no official status. |
| Structure: | ![]() |
| InChI: | InChI=1/C10H8O/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7,11H |
A data sheet from the Compendium of Pesticide Common Names